C11H11F4NO — CID 67022287
1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-3-ol (PubChem CID 67022287) has the molecular formula C11H11F4NO and a molecular weight of 249.21 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
| Compound Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 67022287 |
| Molecular Formula | C11H11F4NO |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(c2ccc(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C11H11F4NO/c12-7-1-2-10(9(5-7)11(13,14)15)16-4-3-8(17)6-16/h1-2,5,8,17H,3-4,6H2 |
| InChIKey | RTQUFKCUXSBWDG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |