C13H16F4N2O2S — CID 91101131
4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-1-methylsulfonylpiperazine (PubChem CID 91101131) has the molecular formula C13H16F4N2O2S and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-1-methylsulfonylpiperazine.
| Compound Name | 4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-1-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 91101131 |
| Molecular Formula | C13H16F4N2O2S |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-[4-fluoro-2-(trifluoromethyl)phenyl]-2-methyl-1-methylsulfonylpiperazine |
| SMILES | CC1CN(c2ccc(F)cc2C(F)(F)F)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C13H16F4N2O2S/c1-9-8-18(5-6-19(9)22(2,20)21)12-4-3-10(14)7-11(12)13(15,16)17/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | PHMGNVDFQRQDTI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |