C13H16FN3O2S — CID 75445341
5-fluoro-2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]benzonitrile (PubChem CID 75445341) has the molecular formula C13H16FN3O2S and a molecular weight of 297.36 g/mol. Its IUPAC name is 5-fluoro-2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]benzonitrile.
| Compound Name | 5-fluoro-2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 75445341 |
| Molecular Formula | C13H16FN3O2S |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-fluoro-2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]benzonitrile |
| SMILES | C[C@H]1CN(c2ccc(F)cc2C#N)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C13H16FN3O2S/c1-10-9-16(5-6-17(10)20(2,18)19)13-4-3-12(14)7-11(13)8-15/h3-4,7,10H,5-6,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | VCROFXGCFIZRAQ-JTQLQIEISA-N |
| XLogP | 1.17 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |