C23H41N7 — CID 111568819
1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine (PubChem CID 111568819) has the molecular formula C23H41N7 and a molecular weight of 415.63 g/mol. Its IUPAC name is 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111568819 |
| Molecular Formula | C23H41N7 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.34 |
| IUPAC Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine |
| SMILES | CCC1CCCCN1CCN/C(=N\C)NCc1ccc(N2CCN(CC)CC2)nc1 |
| InChI | InChI=1S/C23H41N7/c1-4-21-8-6-7-12-29(21)13-11-25-23(24-3)27-19-20-9-10-22(26-18-20)30-16-14-28(5-2)15-17-30/h9-10,18,21H,4-8,11-17,19H2,1-3H3,(H2,24,25,27) |
| InChIKey | NPGQSZOTKKJUAD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|