C23H42IN7 — CID 111321045
1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111321045) has the molecular formula C23H42IN7 and a molecular weight of 543.54 g/mol. Its IUPAC name is 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111321045 |
| Molecular Formula | C23H42IN7 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN1CCN(c2ccc(CN/C(=N/C)NCC(C)(C)N3CCCCC3)cn2)CC1.I |
| InChI | InChI=1S/C23H41N7.HI/c1-5-28-13-15-29(16-14-28)21-10-9-20(17-25-21)18-26-22(24-4)27-19-23(2,3)30-11-7-6-8-12-30;/h9-10,17H,5-8,11-16,18-19H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | YBKNOQBGCXHAOJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|