C18H32N6O — CID 111569667
1-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111569667) has the molecular formula C18H32N6O and a molecular weight of 348.50 g/mol. Its IUPAC name is 1-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569667 |
| Molecular Formula | C18H32N6O |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 1-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\CC1(C(=O)N(C)C)CCCC1)NCCCn1cccn1 |
| InChI | InChI=1S/C18H32N6O/c1-4-19-17(20-11-7-13-24-14-8-12-22-24)21-15-18(9-5-6-10-18)16(25)23(2)3/h8,12,14H,4-7,9-11,13,15H2,1-3H3,(H2,19,20,21) |
| InChIKey | PWFXZINTESJEAP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|