C22H45IN6O — CID 111569800
1-[[[ethylamino-[4-(4-ethylpiperazin-1-yl)butylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111569800) has the molecular formula C22H45IN6O and a molecular weight of 536.55 g/mol. Its IUPAC name is 1-[[[ethylamino-[4-(4-ethylpiperazin-1-yl)butylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[ethylamino-[4-(4-ethylpiperazin-1-yl)butylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111569800 |
| Molecular Formula | C22H45IN6O |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 1-[[[ethylamino-[4-(4-ethylpiperazin-1-yl)butylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(C(=O)N(C)C)CCCC1)NCCCCN1CCN(CC)CC1.I |
| InChI | InChI=1S/C22H44N6O.HI/c1-5-23-21(25-19-22(11-7-8-12-22)20(29)26(3)4)24-13-9-10-14-28-17-15-27(6-2)16-18-28;/h5-19H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | RIKVXMFICRUYDP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|