C17H33N5O2 — CID 111569999
N,N-dimethyl-1-[[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide (PubChem CID 111569999) has the molecular formula C17H33N5O2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N,N-dimethyl-1-[[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide.
| Compound Name | N,N-dimethyl-1-[[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569999 |
| Molecular Formula | C17H33N5O2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | N,N-dimethyl-1-[[[N'-methyl-N-[(4-methylmorpholin-2-yl)methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide |
| SMILES | C/N=C(/NCC1CN(C)CCO1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C17H33N5O2/c1-18-16(19-11-14-12-22(4)9-10-24-14)20-13-17(7-5-6-8-17)15(23)21(2)3/h14H,5-13H2,1-4H3,(H2,18,19,20) |
| InChIKey | RNTCKQRPUDXAAC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|