C22H36N4O2 — CID 111570541
1-[[[ethylamino-[3-(3-methoxyphenyl)propylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111570541) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[[[ethylamino-[3-(3-methoxyphenyl)propylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[ethylamino-[3-(3-methoxyphenyl)propylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111570541 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-[[[ethylamino-[3-(3-methoxyphenyl)propylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\CC1(C(=O)N(C)C)CCCC1)NCCCc1cccc(OC)c1 |
| InChI | InChI=1S/C22H36N4O2/c1-5-23-21(24-15-9-11-18-10-8-12-19(16-18)28-4)25-17-22(13-6-7-14-22)20(27)26(2)3/h8,10,12,16H,5-7,9,11,13-15,17H2,1-4H3,(H2,23,24,25) |
| InChIKey | NKPXEKMUQUFWKI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|