C26H23ClF5N5O — CID 11157119
6-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-2-quinolin-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 11157119) has the molecular formula C26H23ClF5N5O and a molecular weight of 551.95 g/mol. Its IUPAC name is 6-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-2-quinolin-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-2-quinolin-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 11157119 |
| Molecular Formula | C26H23ClF5N5O |
| Molecular Weight | 551.95 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 6-chloro-5-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-2-quinolin-2-yl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | CN(C)CCCOc1cc(F)c(-c2c(Cl)nc(-c3ccc4ccccc4n3)nc2NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C26H23ClF5N5O/c1-37(2)10-5-11-38-16-12-17(28)21(18(29)13-16)22-23(27)35-24(36-25(22)33-14-26(30,31)32)20-9-8-15-6-3-4-7-19(15)34-20/h3-4,6-9,12-13H,5,10-11,14H2,1-2H3,(H,33,35,36) |
| InChIKey | DDOWVXUYVOTAEQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.95 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|