C21H41IN6O2 — CID 111571220
1-[4-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111571220) has the molecular formula C21H41IN6O2 and a molecular weight of 536.50 g/mol. Its IUPAC name is 1-[4-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111571220 |
| Molecular Formula | C21H41IN6O2 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 1-[4-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCCN1CCC(C(N)=O)CC1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C21H40N6O2.HI/c1-23-20(25-16-21(10-4-5-11-21)19(29)26(2)3)24-12-6-7-13-27-14-8-17(9-15-27)18(22)28;/h17H,4-16H2,1-3H3,(H2,22,28)(H2,23,24,25);1H |
| InChIKey | WUMVXCJBTUQPMM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|