C32H59NO6 — CID 11157147
(3S)-3-[[(Z)-octadec-9-enyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol (PubChem CID 11157147) has the molecular formula C32H59NO6 and a molecular weight of 553.83 g/mol. Its IUPAC name is (3S)-3-[[(Z)-octadec-9-enyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol.
| Compound Name | (3S)-3-[[(Z)-octadec-9-enyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 11157147 |
| Molecular Formula | C32H59NO6 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.43 |
| IUPAC Name | (3S)-3-[[(Z)-octadec-9-enyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN[C@@H](CCO)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C32H59NO6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-33-25(22-24-34)26-27-28(37-31(2,3)36-27)29-30(35-26)39-32(4,5)38-29/h13-14,25-30,33-34H,6-12,15-24H2,1-5H3/b14-13-/t25-,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | LDLIMXCWYGRBRF-DXQQTADDSA-N |
| XLogP | 6.76 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|