C22H35IN6O — CID 111572014
1-[[[ethylamino-[2-(2-methylbenzimidazol-1-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111572014) has the molecular formula C22H35IN6O and a molecular weight of 526.47 g/mol. Its IUPAC name is 1-[[[ethylamino-[2-(2-methylbenzimidazol-1-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[ethylamino-[2-(2-methylbenzimidazol-1-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111572014 |
| Molecular Formula | C22H35IN6O |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 1-[[[ethylamino-[2-(2-methylbenzimidazol-1-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(C(=O)N(C)C)CCCC1)NCCn1c(C)nc2ccccc21.I |
| InChI | InChI=1S/C22H34N6O.HI/c1-5-23-21(25-16-22(12-8-9-13-22)20(29)27(3)4)24-14-15-28-17(2)26-18-10-6-7-11-19(18)28;/h6-7,10-11H,5,8-9,12-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | OJEULAIWRQKNHM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|