C23H35N5O — CID 111572263
1-[[[ethylamino-[2-(4-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111572263) has the molecular formula C23H35N5O and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-[[[ethylamino-[2-(4-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[ethylamino-[2-(4-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111572263 |
| Molecular Formula | C23H35N5O |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 1-[[[ethylamino-[2-(4-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\CC1(C(=O)N(C)C)CCCC1)NCCc1c[nH]c2cccc(C)c12 |
| InChI | InChI=1S/C23H35N5O/c1-5-24-22(27-16-23(12-6-7-13-23)21(29)28(3)4)25-14-11-18-15-26-19-10-8-9-17(2)20(18)19/h8-10,15,26H,5-7,11-14,16H2,1-4H3,(H2,24,25,27) |
| InChIKey | JOLIZUZVFBJIAV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|