C19H22BrN5O — CID 111572529
2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide (PubChem CID 111572529) has the molecular formula C19H22BrN5O and a molecular weight of 416.32 g/mol. Its IUPAC name is 2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111572529 |
| Molecular Formula | C19H22BrN5O |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[[N-[[1-(3-bromophenyl)cyclopropyl]methyl]-N'-methylcarbamimidoyl]amino]-N-pyridin-3-ylacetamide |
| SMILES | C/N=C(\NCC(=O)Nc1cccnc1)NCC1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C19H22BrN5O/c1-21-18(23-12-17(26)25-16-6-3-9-22-11-16)24-13-19(7-8-19)14-4-2-5-15(20)10-14/h2-6,9-11H,7-8,12-13H2,1H3,(H,25,26)(H2,21,23,24) |
| InChIKey | OTJOMQMJDZAQHH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|