C18H25BrN6 — CID 111572621
1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111572621) has the molecular formula C18H25BrN6 and a molecular weight of 405.34 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111572621 |
| Molecular Formula | C18H25BrN6 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nncn1CC)NCC1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H25BrN6/c1-3-20-17(21-11-16-24-23-13-25(16)4-2)22-12-18(8-9-18)14-6-5-7-15(19)10-14/h5-7,10,13H,3-4,8-9,11-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | PCBOLWWXMLUNBZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|