C22H28BrIN4O — CID 111572772
4-[[[[[1-(3-bromophenyl)cyclopropyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111572772) has the molecular formula C22H28BrIN4O and a molecular weight of 571.30 g/mol. Its IUPAC name is 4-[[[[[1-(3-bromophenyl)cyclopropyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 4-[[[[[1-(3-bromophenyl)cyclopropyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111572772 |
| Molecular Formula | C22H28BrIN4O |
| Molecular Weight | 571.30 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | 4-[[[[[1-(3-bromophenyl)cyclopropyl]methylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC)cc1)NCC1(c2cccc(Br)c2)CC1.I |
| InChI | InChI=1S/C22H27BrN4O.HI/c1-3-25-21(26-14-16-7-9-17(10-8-16)20(28)24-2)27-15-22(11-12-22)18-5-4-6-19(23)13-18;/h4-10,13H,3,11-12,14-15H2,1-2H3,(H,24,28)(H2,25,26,27);1H |
| InChIKey | GVZIGHJKWIGYAD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|