C15H30N4O3S — CID 111573459
1-(2-tert-butylsulfonylethyl)-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111573459) has the molecular formula C15H30N4O3S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111573459 |
| Molecular Formula | C15H30N4O3S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCC1)NCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H30N4O3S/c1-5-16-14(17-8-11-23(21,22)15(2,3)4)18-12-13(20)19-9-6-7-10-19/h5-12H2,1-4H3,(H2,16,17,18) |
| InChIKey | BIGKBFRCRYEUSB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|