C15H31N5O3S — CID 111929111
1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111929111) has the molecular formula C15H31N5O3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111929111 |
| Molecular Formula | C15H31N5O3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCC1)NCCCN(C)S(=O)(=O)CC |
| InChI | InChI=1S/C15H31N5O3S/c1-4-16-15(18-13-14(21)20-11-6-7-12-20)17-9-8-10-19(3)24(22,23)5-2/h4-13H2,1-3H3,(H2,16,17,18) |
| InChIKey | KULDACQQJHACTF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|