C15H32IN3O2S — CID 111573490
2-(2-tert-butylsulfonylethyl)-1-cyclohexyl-3-ethylguanidine;hydroiodide (PubChem CID 111573490) has the molecular formula C15H32IN3O2S and a molecular weight of 445.41 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethyl)-1-cyclohexyl-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(2-tert-butylsulfonylethyl)-1-cyclohexyl-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573490 |
| Molecular Formula | C15H32IN3O2S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-(2-tert-butylsulfonylethyl)-1-cyclohexyl-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)C(C)(C)C)NC1CCCCC1.I |
| InChI | InChI=1S/C15H31N3O2S.HI/c1-5-16-14(18-13-9-7-6-8-10-13)17-11-12-21(19,20)15(2,3)4;/h13H,5-12H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | OUUWIKPIARRNIG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|