C17H34N4O4S — CID 111830625
ethyl 4-[[N'-(2-tert-butylsulfonylethyl)-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111830625) has the molecular formula C17H34N4O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is ethyl 4-[[N'-(2-tert-butylsulfonylethyl)-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-(2-tert-butylsulfonylethyl)-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111830625 |
| Molecular Formula | C17H34N4O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | ethyl 4-[[N'-(2-tert-butylsulfonylethyl)-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CCS(=O)(=O)C(C)(C)C)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H34N4O4S/c1-6-18-15(19-10-13-26(23,24)17(3,4)5)20-14-8-11-21(12-9-14)16(22)25-7-2/h14H,6-13H2,1-5H3,(H2,18,19,20) |
| InChIKey | TUEYFOQGUVJTQL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|