C12H20N2O2S — CID 111577113
4-tert-butyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide (PubChem CID 111577113) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111577113 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-tert-butyl-N-(3-hydroxybutyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(O)CCNC(=O)c1scnc1C(C)(C)C |
| InChI | InChI=1S/C12H20N2O2S/c1-8(15)5-6-13-11(16)9-10(12(2,3)4)14-7-17-9/h7-8,15H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | MLKFUXUMJPLUBS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |