C23H31IN4O3 — CID 111577362
N-[3-[2-[[N-[[2-(cyclopropylmethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide (PubChem CID 111577362) has the molecular formula C23H31IN4O3 and a molecular weight of 538.43 g/mol. Its IUPAC name is N-[3-[2-[[N-[[2-(cyclopropylmethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[2-[[N-[[2-(cyclopropylmethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111577362 |
| Molecular Formula | C23H31IN4O3 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | N-[3-[2-[[N-[[2-(cyclopropylmethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1cccc(NC(C)=O)c1)NCc1ccccc1OCC1CC1.I |
| InChI | InChI=1S/C23H30N4O3.HI/c1-17(28)27-20-7-5-8-21(14-20)29-13-12-25-23(24-2)26-15-19-6-3-4-9-22(19)30-16-18-10-11-18;/h3-9,14,18H,10-13,15-16H2,1-2H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | RTVJUCFTDMZCCS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|