C20H26FIN4O3S — CID 111578366
4-[[[N-[2-(2-fluorophenyl)sulfonylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111578366) has the molecular formula C20H26FIN4O3S and a molecular weight of 548.42 g/mol. Its IUPAC name is 4-[[[N-[2-(2-fluorophenyl)sulfonylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[N-[2-(2-fluorophenyl)sulfonylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111578366 |
| Molecular Formula | C20H26FIN4O3S |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 4-[[[N-[2-(2-fluorophenyl)sulfonylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)c1ccccc1F)NCc1ccc(C(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C20H25FN4O3S.HI/c1-22-20(23-12-13-29(27,28)18-7-5-4-6-17(18)21)24-14-15-8-10-16(11-9-15)19(26)25(2)3;/h4-11H,12-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | IVNOVCSBDXVKFP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|