C18H20ClN5S — CID 111581107
1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111581107) has the molecular formula C18H20ClN5S and a molecular weight of 373.91 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111581107 |
| Molecular Formula | C18H20ClN5S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccs1)NCc1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H20ClN5S/c1-20-18(21-9-8-17-3-2-10-25-17)22-11-14-12-23-24(13-14)16-6-4-15(19)5-7-16/h2-7,10,12-13H,8-9,11H2,1H3,(H2,20,21,22) |
| InChIKey | CDHSZUKAKAHXQE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|