C19H35IN4OS — CID 111581719
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111581719) has the molecular formula C19H35IN4OS and a molecular weight of 494.49 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111581719 |
| Molecular Formula | C19H35IN4OS |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CC(C)OC(C)C1)NCC(C)(C)c1cccs1.I |
| InChI | InChI=1S/C19H34N4OS.HI/c1-15-12-23(13-16(2)24-15)10-7-9-21-18(20-5)22-14-19(3,4)17-8-6-11-25-17;/h6,8,11,15-16H,7,9-10,12-14H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | ZGBWRKPYPBKCMH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|