C34H34Br2N2O3 — CID 11158192
[3-bromo-5-[6-[5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-3-pyridinyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 11158192) has the molecular formula C34H34Br2N2O3 and a molecular weight of 678.47 g/mol. Its IUPAC name is [3-bromo-5-[6-[5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-3-pyridinyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [3-bromo-5-[6-[5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-3-pyridinyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11158192 |
| Molecular Formula | C34H34Br2N2O3 |
| Molecular Weight | 678.47 g/mol |
| Exact Mass | 676.09 |
| IUPAC Name | [3-bromo-5-[6-[5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-3-pyridinyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(Br)cc(-c2ccc(-c3ccc(-c4cc(Br)cc(COCCCCCC)c4)cn3)nc2)c1 |
| InChI | InChI=1S/C34H34Br2N2O3/c1-4-5-6-7-12-40-21-24-13-28(17-30(35)15-24)26-8-10-32(37-19-26)33-11-9-27(20-38-33)29-14-25(16-31(36)18-29)22-41-34(39)23(2)3/h8-11,13-20H,2,4-7,12,21-22H2,1,3H3 |
| InChIKey | FECIFUBVDGQKJF-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.47 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|