C40H44N2O2 — CID 86048374
5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-[5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-pyridinyl]pyridine (PubChem CID 86048374) has the molecular formula C40H44N2O2 and a molecular weight of 584.80 g/mol. Its IUPAC name is 5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-[5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-pyridinyl]pyridine.
| Compound Name | 5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-[5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 86048374 |
| Molecular Formula | C40H44N2O2 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-[5-[3-ethynyl-5-(hexoxymethyl)phenyl]-2-pyridinyl]pyridine |
| SMILES | C#Cc1cc(COCCCCCC)cc(-c2ccc(-c3ccc(-c4cc(C#C)cc(COCCCCCC)c4)cn3)nc2)c1 |
| InChI | InChI=1S/C40H44N2O2/c1-5-9-11-13-19-43-29-33-21-31(7-3)23-37(25-33)35-15-17-39(41-27-35)40-18-16-36(28-42-40)38-24-32(8-4)22-34(26-38)30-44-20-14-12-10-6-2/h3-4,15-18,21-28H,5-6,9-14,19-20,29-30H2,1-2H3 |
| InChIKey | FIWGRBRVLHPOHD-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|