C20H31IN4OS — CID 111582479
1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111582479) has the molecular formula C20H31IN4OS and a molecular weight of 502.47 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111582479 |
| Molecular Formula | C20H31IN4OS |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C)c(OC)c1C)NCC(C)(C)c1cccs1.I |
| InChI | InChI=1S/C20H30N4OS.HI/c1-7-21-19(24-13-20(4,5)17-9-8-10-26-17)23-12-16-15(3)18(25-6)14(2)11-22-16;/h8-11H,7,12-13H2,1-6H3,(H2,21,23,24);1H |
| InChIKey | KVQLMTCEYVPUPO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|