C22H33N5O2S — CID 111283711
1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283711) has the molecular formula C22H33N5O2S and a molecular weight of 431.61 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283711 |
| Molecular Formula | C22H33N5O2S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-ethyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)c(OC)c1C)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C22H33N5O2S/c1-5-23-22(25-14-18-17(3)21(28-4)16(2)13-24-18)26-15-19(20-7-6-12-30-20)27-8-10-29-11-9-27/h6-7,12-13,19H,5,8-11,14-15H2,1-4H3,(H2,23,25,26) |
| InChIKey | KYSGUVPISZLHLA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|