C16H20Cl2N4O — CID 111584552
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111584552) has the molecular formula C16H20Cl2N4O and a molecular weight of 355.27 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111584552 |
| Molecular Formula | C16H20Cl2N4O |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cc(C(C)C)no1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H20Cl2N4O/c1-10(2)15-7-13(23-22-15)9-21-16(19-3)20-8-11-4-5-12(17)6-14(11)18/h4-7,10H,8-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | ICFDAWDIJRPKQI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|