C19H28ClN5O — CID 111985995
1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111985995) has the molecular formula C19H28ClN5O and a molecular weight of 377.92 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111985995 |
| Molecular Formula | C19H28ClN5O |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cc(C(C)C)no1)NCC(c1ccc(Cl)cc1)N(C)C |
| InChI | InChI=1S/C19H28ClN5O/c1-13(2)17-10-16(26-24-17)11-22-19(21-3)23-12-18(25(4)5)14-6-8-15(20)9-7-14/h6-10,13,18H,11-12H2,1-5H3,(H2,21,22,23) |
| InChIKey | NPPJJCQWJSSEFH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|