C16H28F3N5O — CID 111585761
1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111585761) has the molecular formula C16H28F3N5O and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111585761 |
| Molecular Formula | C16H28F3N5O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-ethyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C16H28F3N5O/c1-5-20-15(21-7-6-8-24(4)11-16(17,18)19)22-10-13-9-14(12(2)3)23-25-13/h9,12H,5-8,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | KYQIQZFPFJFKRN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|