C20H30IN5O3 — CID 111586464
N-[3-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide (PubChem CID 111586464) has the molecular formula C20H30IN5O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is N-[3-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111586464 |
| Molecular Formula | C20H30IN5O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | N-[3-[2-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethoxy]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCCOc1cccc(NC(C)=O)c1.I |
| InChI | InChI=1S/C20H29N5O3.HI/c1-5-21-20(23-13-18-12-19(14(2)3)25-28-18)22-9-10-27-17-8-6-7-16(11-17)24-15(4)26;/h6-8,11-12,14H,5,9-10,13H2,1-4H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | ILXNHHZQUIQKIH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|