C18H29N5OS — CID 111587499
2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111587499) has the molecular formula C18H29N5OS and a molecular weight of 363.53 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111587499 |
| Molecular Formula | C18H29N5OS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1csc(C(C)(C)C)n1)NCc1cc(C(C)C)no1 |
| InChI | InChI=1S/C18H29N5OS/c1-7-19-17(21-10-14-8-15(12(2)3)23-24-14)20-9-13-11-25-16(22-13)18(4,5)6/h8,11-12H,7,9-10H2,1-6H3,(H2,19,20,21) |
| InChIKey | NQYFPEYIHXCKGM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|