C17H27N5OS — CID 109432045
2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine (PubChem CID 109432045) has the molecular formula C17H27N5OS and a molecular weight of 349.50 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine.
| Compound Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109432045 |
| Molecular Formula | C17H27N5OS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1csc(C(C)(C)C)n1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C17H27N5OS/c1-7-18-16(20-9-14-21-11(2)12(3)23-14)19-8-13-10-24-15(22-13)17(4,5)6/h10H,7-9H2,1-6H3,(H2,18,19,20) |
| InChIKey | MKQBCOXCQAYPNV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|