C20H26IN5O2S — CID 109431912
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 109431912) has the molecular formula C20H26IN5O2S and a molecular weight of 527.43 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109431912 |
| Molecular Formula | C20H26IN5O2S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(-c2ccc(OC)cc2)n1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C20H25N5O2S.HI/c1-5-21-20(23-11-18-24-13(2)14(3)27-18)22-10-16-12-28-19(25-16)15-6-8-17(26-4)9-7-15;/h6-9,12H,5,10-11H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | CMALQQLSNGIYDH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|