C11H23N3O — CID 111587817
1-ethyl-2-(2-methoxyethyl)-3-pent-3-enylguanidine (PubChem CID 111587817) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-ethyl-2-(2-methoxyethyl)-3-pent-3-enylguanidine.
| Compound Name | 1-ethyl-2-(2-methoxyethyl)-3-pent-3-enylguanidine |
|---|---|
| PubChem CID | 111587817 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1-ethyl-2-(2-methoxyethyl)-3-pent-3-enylguanidine |
| SMILES | CC=CCCN/C(=N/CCOC)NCC |
| InChI | InChI=1S/C11H23N3O/c1-4-6-7-8-13-11(12-5-2)14-9-10-15-3/h4,6H,5,7-10H2,1-3H3,(H2,12,13,14) |
| InChIKey | UXAKHUYIYRQPPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|