C25H24FN5O2 — CID 111590543
1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine (PubChem CID 111590543) has the molecular formula C25H24FN5O2 and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine.
| Compound Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111590543 |
| Molecular Formula | C25H24FN5O2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1coc(-c2ccc(C)cc2)n1)NCc1cccnc1Oc1cccc(F)c1 |
| InChI | InChI=1S/C25H24FN5O2/c1-17-8-10-18(11-9-17)24-31-21(16-32-24)15-30-25(27-2)29-14-19-5-4-12-28-23(19)33-22-7-3-6-20(26)13-22/h3-13,16H,14-15H2,1-2H3,(H2,27,29,30) |
| InChIKey | VMZVOILOHXZVKQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|