C25H31IN6O2 — CID 111591978
1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111591978) has the molecular formula C25H31IN6O2 and a molecular weight of 574.47 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591978 |
| Molecular Formula | C25H31IN6O2 |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCNC(=O)C2)cc1)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C25H30N6O2.HI/c1-3-26-25(29-15-21-17-33-24(30-21)20-8-4-18(2)5-9-20)28-14-19-6-10-22(11-7-19)31-13-12-27-23(32)16-31;/h4-11,17H,3,12-16H2,1-2H3,(H,27,32)(H2,26,28,29);1H |
| InChIKey | YWOBKECHEGQJDE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|