C21H31IN6O — CID 111595485
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111595485) has the molecular formula C21H31IN6O and a molecular weight of 510.42 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111595485 |
| Molecular Formula | C21H31IN6O |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C21H30N6O.HI/c1-15-26-16-9-6-7-10-17(16)27(15)12-8-11-23-20(22-5)25-14-19-24-13-18(28-19)21(2,3)4;/h6-7,9-10,13H,8,11-12,14H2,1-5H3,(H2,22,23,25);1H |
| InChIKey | ZLFNDYSDRMWRQW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|