C10H12O3 — CID 11159658
6-ethenyl-5,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 11159658) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 6-ethenyl-5,6-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 6-ethenyl-5,6-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 11159658 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 6-ethenyl-5,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | C=CC1(OC)C(=O)C=CC=C1OC |
| InChI | InChI=1S/C10H12O3/c1-4-10(13-3)8(11)6-5-7-9(10)12-2/h4-7H,1H2,2-3H3 |
| InChIKey | KCUAGDROALRVFL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|