C8H10O3 — CID 141369105
5,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 141369105) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 5,6-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 5,6-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141369105 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC=CC(=O)C1OC |
| InChI | InChI=1S/C8H10O3/c1-10-7-5-3-4-6(9)8(7)11-2/h3-5,8H,1-2H3 |
| InChIKey | JIXQMMOFPSTMSN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |