C11H13ClN2O2S — CID 111596999
6-chloro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-2-carboxamide (PubChem CID 111596999) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 6-chloro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 111596999 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 6-chloro-N-[(3-hydroxythiolan-3-yl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCC1(O)CCSC1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C11H13ClN2O2S/c12-9-3-1-2-8(14-9)10(15)13-6-11(16)4-5-17-7-11/h1-3,16H,4-7H2,(H,13,15) |
| InChIKey | VYESIDRZGFNFFA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|