C8H11N3O2S2 — CID 166208940
N-[(3-hydroxythiolan-3-yl)methyl]thiadiazole-5-carboxamide (PubChem CID 166208940) has the molecular formula C8H11N3O2S2 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-[(3-hydroxythiolan-3-yl)methyl]thiadiazole-5-carboxamide.
| Compound Name | N-[(3-hydroxythiolan-3-yl)methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 166208940 |
| Molecular Formula | C8H11N3O2S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | N-[(3-hydroxythiolan-3-yl)methyl]thiadiazole-5-carboxamide |
| SMILES | O=C(NCC1(O)CCSC1)c1cnns1 |
| InChI | InChI=1S/C8H11N3O2S2/c12-7(6-3-10-11-15-6)9-4-8(13)1-2-14-5-8/h3,13H,1-2,4-5H2,(H,9,12) |
| InChIKey | WUMDPKLJXQIPTJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |