C15H16N2O3S — CID 111596930
N-[(3-hydroxythiolan-3-yl)methyl]-4-(1,3-oxazol-5-yl)benzamide (PubChem CID 111596930) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[(3-hydroxythiolan-3-yl)methyl]-4-(1,3-oxazol-5-yl)benzamide.
| Compound Name | N-[(3-hydroxythiolan-3-yl)methyl]-4-(1,3-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 111596930 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-[(3-hydroxythiolan-3-yl)methyl]-4-(1,3-oxazol-5-yl)benzamide |
| SMILES | O=C(NCC1(O)CCSC1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C15H16N2O3S/c18-14(17-8-15(19)5-6-21-9-15)12-3-1-11(2-4-12)13-7-16-10-20-13/h1-4,7,10,19H,5-6,8-9H2,(H,17,18) |
| InChIKey | NHYNPMIUFZKWJF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |