C6H8N4OS2 — CID 65215199
N-(3-amino-3-sulfanylidenepropyl)thiadiazole-5-carboxamide (PubChem CID 65215199) has the molecular formula C6H8N4OS2 and a molecular weight of 216.29 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)thiadiazole-5-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65215199 |
| Molecular Formula | C6H8N4OS2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)thiadiazole-5-carboxamide |
| SMILES | NC(=S)CCNC(=O)c1cnns1 |
| InChI | InChI=1S/C6H8N4OS2/c7-5(12)1-2-8-6(11)4-3-9-10-13-4/h3H,1-2H2,(H2,7,12)(H,8,11) |
| InChIKey | DDRMLKZTQIMXRF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|