C6H9N3O2S — CID 43522681
N-(1-hydroxypropan-2-yl)thiadiazole-5-carboxamide (PubChem CID 43522681) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)thiadiazole-5-carboxamide.
| Compound Name | N-(1-hydroxypropan-2-yl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 43522681 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)thiadiazole-5-carboxamide |
| SMILES | CC(CO)NC(=O)c1cnns1 |
| InChI | InChI=1S/C6H9N3O2S/c1-4(3-10)8-6(11)5-2-7-9-12-5/h2,4,10H,3H2,1H3,(H,8,11) |
| InChIKey | VCKDGDVQODKPSE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |