C6H8FN3OS — CID 126996410
N-[(2S)-1-fluoropropan-2-yl]thiadiazole-5-carboxamide (PubChem CID 126996410) has the molecular formula C6H8FN3OS and a molecular weight of 189.21 g/mol. Its IUPAC name is N-[(2S)-1-fluoropropan-2-yl]thiadiazole-5-carboxamide.
| Compound Name | N-[(2S)-1-fluoropropan-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 126996410 |
| Molecular Formula | C6H8FN3OS |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | N-[(2S)-1-fluoropropan-2-yl]thiadiazole-5-carboxamide |
| SMILES | C[C@@H](CF)NC(=O)c1cnns1 |
| InChI | InChI=1S/C6H8FN3OS/c1-4(2-7)9-6(11)5-3-8-10-12-5/h3-4H,2H2,1H3,(H,9,11)/t4-/m0/s1 |
| InChIKey | NYNXYVWIPWYONS-BYPYZUCNSA-N |
| XLogP | 0.63 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |