C17H15F3N4O2S — CID 111597968
1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111597968) has the molecular formula C17H15F3N4O2S and a molecular weight of 396.39 g/mol. Its IUPAC name is 1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111597968 |
| Molecular Formula | C17H15F3N4O2S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(OC(F)(F)F)cc1)NCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C17H15F3N4O2S/c18-17(19,20)26-13-5-3-11(4-6-13)8-22-16(21)23-9-12-10-25-15(24-12)14-2-1-7-27-14/h1-7,10H,8-9H2,(H3,21,22,23) |
| InChIKey | YMJSHLKXOXHOGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|